ChemNet > CAS > 175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propaanzuur
175205-01-3 2-[(6-methoxy-3-nitro-2-pyridyl)thio]propaanzuur
| Naam product |
2-[(6-methoxy-3-nitro-2-pyridyl)thio]propaanzuur |
| Synoniemen |
2-[(6-methoxy-3-nitropyridine-2-yl)sulfanyl]propaanzuur |
| Engelse naam |
2-[(6-methoxy-3-nitro-2-pyridyl)thio]propanoic acid;2-[(6-methoxy-3-nitropyridin-2-yl)sulfanyl]propanoic acid |
| MF |
C9H10N2O5S |
| Molecuulgewicht |
258.2511 |
| InChI |
InChI=1/C9H10N2O5S/c1-5(9(12)13)17-8-6(11(14)15)3-4-7(10-8)16-2/h3-5H,1-2H3,(H,12,13) |
| CAS-nummer |
175205-01-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.47g/cm3 |
| Smeltpunt |
196℃ |
| Kookpunt |
434.5°C at 760 mmHg |
| Brekingsindex |
1.605 |
| Vlampunt |
216.6°C |
| Dampdruk |
2.56E-08mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|